C11H19NO — CID 123628317
(5-cyclopent-2-en-1-yl-4-methylpyrrolidin-3-yl)methanol (PubChem CID 123628317) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (5-cyclopent-2-en-1-yl-4-methylpyrrolidin-3-yl)methanol.
| Compound Name | (5-cyclopent-2-en-1-yl-4-methylpyrrolidin-3-yl)methanol |
|---|---|
| PubChem CID | 123628317 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (5-cyclopent-2-en-1-yl-4-methylpyrrolidin-3-yl)methanol |
| SMILES | CC1C(CO)CNC1C1C=CCC1 |
| InChI | InChI=1S/C11H19NO/c1-8-10(7-13)6-12-11(8)9-4-2-3-5-9/h2,4,8-13H,3,5-7H2,1H3 |
| InChIKey | JSRMDRXRYRDDPJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|