C15H19N — CID 123628458
5-benzyl-3a-methyl-2,3,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole (PubChem CID 123628458) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-benzyl-3a-methyl-2,3,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 5-benzyl-3a-methyl-2,3,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 123628458 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 5-benzyl-3a-methyl-2,3,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC12CNCC1C=C(Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H19N/c1-15-9-13(8-14(15)10-16-11-15)7-12-5-3-2-4-6-12/h2-6,8,14,16H,7,9-11H2,1H3 |
| InChIKey | OSCKYPPVIQGKCE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|