C16H20 — CID 101348567
(1S,5R,6R)-3-benzyl-6-propylbicyclo[3.1.0]hex-2-ene (PubChem CID 101348567) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is (1S,5R,6R)-3-benzyl-6-propylbicyclo[3.1.0]hex-2-ene.
| Compound Name | (1S,5R,6R)-3-benzyl-6-propylbicyclo[3.1.0]hex-2-ene |
|---|---|
| PubChem CID | 101348567 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (1S,5R,6R)-3-benzyl-6-propylbicyclo[3.1.0]hex-2-ene |
| SMILES | CCC[C@H]1[C@@H]2C=C(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C16H20/c1-2-6-14-15-10-13(11-16(14)15)9-12-7-4-3-5-8-12/h3-5,7-8,10,14-16H,2,6,9,11H2,1H3/t14-,15-,16+/m0/s1 |
| InChIKey | ZJJUVOBNAJMXJA-HRCADAONSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|