C13H18N2 — CID 175140303
2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole (PubChem CID 175140303) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole.
| Compound Name | 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 175140303 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole |
| SMILES | CCC1CN(C)C(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C13H18N2/c1-3-12-10-15(2)13(14-12)9-11-7-5-4-6-8-11/h4-8,12H,3,9-10H2,1-2H3 |
| InChIKey | WSBYMGUCMPVKOH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |