C15H25N3O3S — CID 175589184
2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole;ethylsulfamic acid (PubChem CID 175589184) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole;ethylsulfamic acid.
| Compound Name | 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole;ethylsulfamic acid |
|---|---|
| PubChem CID | 175589184 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-benzyl-4-ethyl-1-methyl-4,5-dihydroimidazole;ethylsulfamic acid |
| SMILES | CCC1CN(C)C(Cc2ccccc2)=N1.CCNS(=O)(=O)O |
| InChI | InChI=1S/C13H18N2.C2H7NO3S/c1-3-12-10-15(2)13(14-12)9-11-7-5-4-6-8-11;1-2-3-7(4,5)6/h4-8,12H,3,9-10H2,1-2H3;3H,2H2,1H3,(H,4,5,6) |
| InChIKey | POJFAWPGSPMHDL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|