C11H16N+ — CID 123628819
1,2,5-trimethyl-4-prop-1-enylpyridin-1-ium (PubChem CID 123628819) has the molecular formula C11H16N+ and a molecular weight of 162.26 g/mol. Its IUPAC name is 1,2,5-trimethyl-4-prop-1-enylpyridin-1-ium.
| Compound Name | 1,2,5-trimethyl-4-prop-1-enylpyridin-1-ium |
|---|---|
| PubChem CID | 123628819 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 1,2,5-trimethyl-4-prop-1-enylpyridin-1-ium |
| SMILES | CC=Cc1cc(C)[n+](C)cc1C |
| InChI | InChI=1S/C11H16N/c1-5-6-11-7-10(3)12(4)8-9(11)2/h5-8H,1-4H3/q+1 |
| InChIKey | PGYCYBYZIYLCOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|