C26H31FN2O3 — CID 123630715
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-14-(2-fluoroethoxy)-8,9-dimethyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5-tetraen-5-amine (PubChem CID 123630715) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-14-(2-fluoroethoxy)-8,9-dimethyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5-tetraen-5-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-14-(2-fluoroethoxy)-8,9-dimethyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5-tetraen-5-amine |
|---|---|
| PubChem CID | 123630715 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-14-(2-fluoroethoxy)-8,9-dimethyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5-tetraen-5-amine |
| SMILES | CC1CC2=C(CC(OCCF)CC2)c2ccc(Nc3ccc4c(c3)OCCO4)nc2C1C |
| InChI | InChI=1S/C26H31FN2O3/c1-16-13-18-3-5-20(30-10-9-27)15-22(18)21-6-8-25(29-26(21)17(16)2)28-19-4-7-23-24(14-19)32-12-11-31-23/h4,6-8,14,16-17,20H,3,5,9-13,15H2,1-2H3,(H,28,29) |
| InChIKey | UIVMTJSKAKOBLD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |