C39H72 — CID 123630915
8-(5,10-dimethylundec-8-yn-5-yl)-6,10,11,12,16-pentamethyl-9-(2-methylpropylidene)heptadec-3-ene (PubChem CID 123630915) has the molecular formula C39H72 and a molecular weight of 541.01 g/mol. Its IUPAC name is 8-(5,10-dimethylundec-8-yn-5-yl)-6,10,11,12,16-pentamethyl-9-(2-methylpropylidene)heptadec-3-ene.
| Compound Name | 8-(5,10-dimethylundec-8-yn-5-yl)-6,10,11,12,16-pentamethyl-9-(2-methylpropylidene)heptadec-3-ene |
|---|---|
| PubChem CID | 123630915 |
| Molecular Formula | C39H72 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.56 |
| IUPAC Name | 8-(5,10-dimethylundec-8-yn-5-yl)-6,10,11,12,16-pentamethyl-9-(2-methylpropylidene)heptadec-3-ene |
| SMILES | CCC=CCC(C)CC(C(=CC(C)C)C(C)C(C)C(C)CCCC(C)C)C(C)(CCC#CC(C)C)CCCC |
| InChI | InChI=1S/C39H72/c1-14-16-18-24-33(9)29-38(39(13,26-17-15-2)27-20-19-22-30(3)4)37(28-32(7)8)36(12)35(11)34(10)25-21-23-31(5)6/h16,18,28,30-36,38H,14-15,17,20-21,23-27,29H2,1-13H3 |
| InChIKey | COYJGXIQMULYJY-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|