About 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine
3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine (PubChem CID 123632856) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine.
Analyze 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine?
The IUPAC name of 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine (CID 123632856) is 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine.
What is the SMILES notation for 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine?
The canonical SMILES for 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine is CCC1CN=CC(C)=C1C(C)C.
What is the InChIKey of 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine?
The InChIKey is GEKFOJFUYHXZEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-5-10-7-12-6-9(4)11(10)8(2)3/h6,8,10H,5,7H2,1-4H3.
What are the key properties of 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine?
3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine has a molecular weight of 165.28 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-4-propan-2-yl-2,3-dihydropyridine is sourced from PubChem (CID 123632856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).