C18H13F3N2O4 — CID 123633996
6-(2,5-dihydroxy-3-prop-1-en-2-ylpyrrol-1-yl)-2,2,7-trifluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 123633996) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 6-(2,5-dihydroxy-3-prop-1-en-2-ylpyrrol-1-yl)-2,2,7-trifluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,5-dihydroxy-3-prop-1-en-2-ylpyrrol-1-yl)-2,2,7-trifluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 123633996 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 6-(2,5-dihydroxy-3-prop-1-en-2-ylpyrrol-1-yl)-2,2,7-trifluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)C(F)(F)Oc2cc(F)c(-n3c(O)cc(C(=C)C)c3O)cc21 |
| InChI | InChI=1S/C18H13F3N2O4/c1-4-5-22-13-8-12(23-15(24)6-10(9(2)3)16(23)25)11(19)7-14(13)27-18(20,21)17(22)26/h1,6-8,24-25H,2,5H2,3H3 |
| InChIKey | MUVXBJDPQSLIBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|