C19H17FN2O4 — CID 91086019
6-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 91086019) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 6-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 91086019 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 6-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)COc2cc(F)c(-n3c(O)c4c(c3O)CCCC4)cc21 |
| InChI | InChI=1S/C19H17FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9,24-25H,3-7,10H2 |
| InChIKey | LQQTWNDGYJSVQS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|