C16H15N5O4S — CID 123634450
methyl 3-[[2-(2,3-dihydro-1-benzofuran-5-yl)-2,5-dihydro-1,3-thiazole-4-carbonyl]amino]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 123634450) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is methyl 3-[[2-(2,3-dihydro-1-benzofuran-5-yl)-2,5-dihydro-1,3-thiazole-4-carbonyl]amino]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | methyl 3-[[2-(2,3-dihydro-1-benzofuran-5-yl)-2,5-dihydro-1,3-thiazole-4-carbonyl]amino]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 123634450 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 3-[[2-(2,3-dihydro-1-benzofuran-5-yl)-2,5-dihydro-1,3-thiazole-4-carbonyl]amino]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)C2=NC(c3ccc4c(c3)CCO4)SC2)n[nH]1 |
| InChI | InChI=1S/C16H15N5O4S/c1-24-15(23)12-18-16(21-20-12)19-13(22)10-7-26-14(17-10)9-2-3-11-8(6-9)4-5-25-11/h2-3,6,14H,4-5,7H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | QQSBIIUMORUGPB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |