C19H21N5O4S — CID 144760828
3-(2,3-dihydro-1-benzofuran-5-yl)-2,7-dihydro-1,4-thiazepine-5-carbaldehyde;methyl 3-(methylamino)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 144760828) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-2,7-dihydro-1,4-thiazepine-5-carbaldehyde;methyl 3-(methylamino)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-2,7-dihydro-1,4-thiazepine-5-carbaldehyde;methyl 3-(methylamino)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 144760828 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-2,7-dihydro-1,4-thiazepine-5-carbaldehyde;methyl 3-(methylamino)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CNc1n[nH]c(C(=O)OC)n1.O=CC1=CCSCC(c2ccc3c(c2)CCO3)=N1 |
| InChI | InChI=1S/C14H13NO2S.C5H8N4O2/c16-8-12-4-6-18-9-13(15-12)10-1-2-14-11(7-10)3-5-17-14;1-6-5-7-3(8-9-5)4(10)11-2/h1-2,4,7-8H,3,5-6,9H2;1-2H3,(H2,6,7,8,9) |
| InChIKey | KVLDXPJDENHISP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|