C20H40N+ — CID 123634732
(4,8-diethyl-2,11-dimethyldodec-1-enyl)-methyl-methylideneazanium (PubChem CID 123634732) has the molecular formula C20H40N+ and a molecular weight of 294.55 g/mol. Its IUPAC name is (4,8-diethyl-2,11-dimethyldodec-1-enyl)-methyl-methylideneazanium.
| Compound Name | (4,8-diethyl-2,11-dimethyldodec-1-enyl)-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123634732 |
| Molecular Formula | C20H40N+ |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.32 |
| IUPAC Name | (4,8-diethyl-2,11-dimethyldodec-1-enyl)-methyl-methylideneazanium |
| SMILES | C=[N+](C)C=C(C)CC(CC)CCCC(CC)CCC(C)C |
| InChI | InChI=1S/C20H40N/c1-8-19(14-13-17(3)4)11-10-12-20(9-2)15-18(5)16-21(6)7/h16-17,19-20H,6,8-15H2,1-5,7H3/q+1 |
| InChIKey | ZWOJRQLFUYSKBN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|