C18H35N — CID 123786169
4-ethyl-N,N-dimethyl-2-pentylnona-1,8-dien-1-amine (PubChem CID 123786169) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is 4-ethyl-N,N-dimethyl-2-pentylnona-1,8-dien-1-amine.
| Compound Name | 4-ethyl-N,N-dimethyl-2-pentylnona-1,8-dien-1-amine |
|---|---|
| PubChem CID | 123786169 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 4-ethyl-N,N-dimethyl-2-pentylnona-1,8-dien-1-amine |
| SMILES | C=CCCCC(CC)CC(=CN(C)C)CCCCC |
| InChI | InChI=1S/C18H35N/c1-6-9-11-13-17(8-3)15-18(16-19(4)5)14-12-10-7-2/h6,16-17H,1,7-15H2,2-5H3 |
| InChIKey | DNNXTTRLDZYDMB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|