C16H31N — CID 134894095
(Z)-9-cyclopropyl-N,N-diethylnon-1-en-1-amine (PubChem CID 134894095) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (Z)-9-cyclopropyl-N,N-diethylnon-1-en-1-amine.
| Compound Name | (Z)-9-cyclopropyl-N,N-diethylnon-1-en-1-amine |
|---|---|
| PubChem CID | 134894095 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (Z)-9-cyclopropyl-N,N-diethylnon-1-en-1-amine |
| SMILES | CCN(/C=C\CCCCCCCC1CC1)CC |
| InChI | InChI=1S/C16H31N/c1-3-17(4-2)15-11-9-7-5-6-8-10-12-16-13-14-16/h11,15-16H,3-10,12-14H2,1-2H3/b15-11- |
| InChIKey | QYQUHOHMEIYVMF-PTNGSMBKSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|