C12H25N — CID 57272761
N,N-diethyl-3-methylhept-1-en-1-amine (PubChem CID 57272761) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is N,N-diethyl-3-methylhept-1-en-1-amine.
| Compound Name | N,N-diethyl-3-methylhept-1-en-1-amine |
|---|---|
| PubChem CID | 57272761 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N,N-diethyl-3-methylhept-1-en-1-amine |
| SMILES | CCCCC(C)C=CN(CC)CC |
| InChI | InChI=1S/C12H25N/c1-5-8-9-12(4)10-11-13(6-2)7-3/h10-12H,5-9H2,1-4H3 |
| InChIKey | DEODLFMYSMMXAR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |