C16H33N — CID 123425143
N-butan-2-yl-5-ethyl-N,3-dimethyloct-1-en-1-amine (PubChem CID 123425143) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N-butan-2-yl-5-ethyl-N,3-dimethyloct-1-en-1-amine.
| Compound Name | N-butan-2-yl-5-ethyl-N,3-dimethyloct-1-en-1-amine |
|---|---|
| PubChem CID | 123425143 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N-butan-2-yl-5-ethyl-N,3-dimethyloct-1-en-1-amine |
| SMILES | CCCC(CC)CC(C)C=CN(C)C(C)CC |
| InChI | InChI=1S/C16H33N/c1-7-10-16(9-3)13-14(4)11-12-17(6)15(5)8-2/h11-12,14-16H,7-10,13H2,1-6H3 |
| InChIKey | BCDVIRVIUVOXHA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |