C20H41N — CID 90980134
N,3,7,11-tetramethylhexadec-1-en-1-amine (PubChem CID 90980134) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is N,3,7,11-tetramethylhexadec-1-en-1-amine.
| Compound Name | N,3,7,11-tetramethylhexadec-1-en-1-amine |
|---|---|
| PubChem CID | 90980134 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | N,3,7,11-tetramethylhexadec-1-en-1-amine |
| SMILES | CCCCCC(C)CCCC(C)CCCC(C)C=CNC |
| InChI | InChI=1S/C20H41N/c1-6-7-8-11-18(2)12-9-13-19(3)14-10-15-20(4)16-17-21-5/h16-21H,6-15H2,1-5H3 |
| InChIKey | PSSIZOQTNWUEJJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|