C21H41N — CID 123564735
5,7-diethyl-N,N,6,9,9-pentamethyldodeca-1,4-dien-1-amine (PubChem CID 123564735) has the molecular formula C21H41N and a molecular weight of 307.57 g/mol. Its IUPAC name is 5,7-diethyl-N,N,6,9,9-pentamethyldodeca-1,4-dien-1-amine.
| Compound Name | 5,7-diethyl-N,N,6,9,9-pentamethyldodeca-1,4-dien-1-amine |
|---|---|
| PubChem CID | 123564735 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | 5,7-diethyl-N,N,6,9,9-pentamethyldodeca-1,4-dien-1-amine |
| SMILES | CCCC(C)(C)CC(CC)C(C)C(=CCC=CN(C)C)CC |
| InChI | InChI=1S/C21H41N/c1-9-15-21(5,6)17-20(11-3)18(4)19(10-2)14-12-13-16-22(7)8/h13-14,16,18,20H,9-12,15,17H2,1-8H3 |
| InChIKey | SASBCUFIXNSHCQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|