C14H31N — CID 90854541
N-ethyl-4,4-dimethyl-N-propan-2-ylheptan-2-amine (PubChem CID 90854541) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is N-ethyl-4,4-dimethyl-N-propan-2-ylheptan-2-amine.
| Compound Name | N-ethyl-4,4-dimethyl-N-propan-2-ylheptan-2-amine |
|---|---|
| PubChem CID | 90854541 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | N-ethyl-4,4-dimethyl-N-propan-2-ylheptan-2-amine |
| SMILES | CCCC(C)(C)CC(C)N(CC)C(C)C |
| InChI | InChI=1S/C14H31N/c1-8-10-14(6,7)11-13(5)15(9-2)12(3)4/h12-13H,8-11H2,1-7H3 |
| InChIKey | HXNVFRBZPOOEEA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |