C26H50 — CID 142414694
(5S,13S)-14-ethyl-3,5,7,7,11,12,13-heptamethyl-10-methylidenehexadec-1-ene (PubChem CID 142414694) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is (5S,13S)-14-ethyl-3,5,7,7,11,12,13-heptamethyl-10-methylidenehexadec-1-ene.
| Compound Name | (5S,13S)-14-ethyl-3,5,7,7,11,12,13-heptamethyl-10-methylidenehexadec-1-ene |
|---|---|
| PubChem CID | 142414694 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | (5S,13S)-14-ethyl-3,5,7,7,11,12,13-heptamethyl-10-methylidenehexadec-1-ene |
| SMILES | C=CC(C)C[C@H](C)CC(C)(C)CCC(=C)C(C)C(C)[C@@H](C)C(CC)CC |
| InChI | InChI=1S/C26H50/c1-12-19(4)17-20(5)18-26(10,11)16-15-21(6)22(7)23(8)24(9)25(13-2)14-3/h12,19-20,22-25H,1,6,13-18H2,2-5,7-11H3/t19?,20-,22?,23?,24+/m0/s1 |
| InChIKey | FVYJWRXJAOLUOA-GHNTZOFMSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|