C20H43N — CID 144712463
N-[(E)-2,9-dimethyldec-1-enyl]methanimine;ethane;pentane (PubChem CID 144712463) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is N-[(E)-2,9-dimethyldec-1-enyl]methanimine;ethane;pentane.
| Compound Name | N-[(E)-2,9-dimethyldec-1-enyl]methanimine;ethane;pentane |
|---|---|
| PubChem CID | 144712463 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N-[(E)-2,9-dimethyldec-1-enyl]methanimine;ethane;pentane |
| SMILES | C=N/C=C(\C)CCCCCCC(C)C.CC.CCCCC |
| InChI | InChI=1S/C13H25N.C5H12.C2H6/c1-12(2)9-7-5-6-8-10-13(3)11-14-4;1-3-5-4-2;1-2/h11-12H,4-10H2,1-3H3;3-5H2,1-2H3;1-2H3/b13-11+;; |
| InChIKey | WMKHIHNJFAXPJV-UAIOKUCGSA-N |
| XLogP | 7.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|