C16H36NP — CID 144837092
N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine;ethane;methylphosphane (PubChem CID 144837092) has the molecular formula C16H36NP and a molecular weight of 273.44 g/mol. Its IUPAC name is N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine;ethane;methylphosphane.
| Compound Name | N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine;ethane;methylphosphane |
|---|---|
| PubChem CID | 144837092 |
| Molecular Formula | C16H36NP |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.26 |
| IUPAC Name | N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine;ethane;methylphosphane |
| SMILES | C=N/C=C(\CC)C(CC)CC(C)(C)C.CC.CP |
| InChI | InChI=1S/C13H25N.C2H6.CH5P/c1-7-11(9-13(3,4)5)12(8-2)10-14-6;2*1-2/h10-11H,6-9H2,1-5H3;1-2H3;2H2,1H3/b12-10+;; |
| InChIKey | VJFGIURQPQBXJF-PFNYCKIMSA-N |
| XLogP | 5.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|