C30H41N3O5 — CID 123635949
N-carbamoyl-1-(cyclopropylmethyl)-7a-hydroxy-N-[(4-hydroxyphenyl)methyl]-3a-[(E)-2-methyl-5-oxohex-3-en-3-yl]-2,2a,3,4,5,6,7,7b-octahydroindeno[1,2-b]azete-5-carboxamide (PubChem CID 123635949) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is N-carbamoyl-1-(cyclopropylmethyl)-7a-hydroxy-N-[(4-hydroxyphenyl)methyl]-3a-[(E)-2-methyl-5-oxohex-3-en-3-yl]-2,2a,3,4,5,6,7,7b-octahydroindeno[1,2-b]azete-5-carboxamide.
| Compound Name | N-carbamoyl-1-(cyclopropylmethyl)-7a-hydroxy-N-[(4-hydroxyphenyl)methyl]-3a-[(E)-2-methyl-5-oxohex-3-en-3-yl]-2,2a,3,4,5,6,7,7b-octahydroindeno[1,2-b]azete-5-carboxamide |
|---|---|
| PubChem CID | 123635949 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | N-carbamoyl-1-(cyclopropylmethyl)-7a-hydroxy-N-[(4-hydroxyphenyl)methyl]-3a-[(E)-2-methyl-5-oxohex-3-en-3-yl]-2,2a,3,4,5,6,7,7b-octahydroindeno[1,2-b]azete-5-carboxamide |
| SMILES | CC(=O)/C=C(\C(C)C)C12CC(C(=O)N(Cc3ccc(O)cc3)C(N)=O)CCC1(O)C1C(CN1CC1CC1)C2 |
| InChI | InChI=1S/C30H41N3O5/c1-18(2)25(12-19(3)34)29-13-22(27(36)33(28(31)37)16-21-6-8-24(35)9-7-21)10-11-30(29,38)26-23(14-29)17-32(26)15-20-4-5-20/h6-9,12,18,20,22-23,26,35,38H,4-5,10-11,13-17H2,1-3H3,(H2,31,37)/b25-12+ |
| InChIKey | XVLWLWBXBBERGT-BRJLIKDPSA-N |
| XLogP | 3.60 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|