C26H34N2O5 — CID 123750997
12-(cyclopropylmethyl)-10-hydroxy-1-[(E)-5-methyl-2-oxohept-3-en-4-yl]-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxylic acid (PubChem CID 123750997) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 12-(cyclopropylmethyl)-10-hydroxy-1-[(E)-5-methyl-2-oxohept-3-en-4-yl]-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxylic acid.
| Compound Name | 12-(cyclopropylmethyl)-10-hydroxy-1-[(E)-5-methyl-2-oxohept-3-en-4-yl]-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 123750997 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 12-(cyclopropylmethyl)-10-hydroxy-1-[(E)-5-methyl-2-oxohept-3-en-4-yl]-5-oxo-4,12-diazatetracyclo[8.5.0.03,8.011,14]pentadeca-3(8),6-diene-6-carboxylic acid |
| SMILES | CCC(C)/C(=C\C(C)=O)C12Cc3[nH]c(=O)c(C(=O)O)cc3CC1(O)C1C(CN1CC1CC1)C2 |
| InChI | InChI=1S/C26H34N2O5/c1-4-14(2)20(7-15(3)29)25-9-18-13-28(12-16-5-6-16)22(18)26(25,33)10-17-8-19(24(31)32)23(30)27-21(17)11-25/h7-8,14,16,18,22,33H,4-6,9-13H2,1-3H3,(H,27,30)(H,31,32)/b20-7+ |
| InChIKey | NJNXNSNWGATQRF-IFRROFPPSA-N |
| XLogP | 2.56 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|