C24H22ClN3O4 — CID 123637113
6-[[6-chloro-5-(4-phenylcyclohexa-2,4-dien-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 123637113) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is 6-[[6-chloro-5-(4-phenylcyclohexa-2,4-dien-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[[6-chloro-5-(4-phenylcyclohexa-2,4-dien-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 123637113 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 6-[[6-chloro-5-(4-phenylcyclohexa-2,4-dien-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OC1COC2C(Oc3nc4nc(C5C=CC(c6ccccc6)=CC5)c(Cl)cc4[nH]3)COC12 |
| InChI | InChI=1S/C24H22ClN3O4/c25-16-10-17-23(28-24(26-17)32-19-12-31-21-18(29)11-30-22(19)21)27-20(16)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-8,10,15,18-19,21-22,29H,9,11-12H2,(H,26,27,28) |
| InChIKey | VDTUGCCVEXZMLJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |