C26H32N6O2S — CID 123637489
[2-[4-[(2,6-dimethylmorpholin-4-yl)methyl]octa-3,5,7-trienoxy]pyrimidin-4-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanamine (PubChem CID 123637489) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is [2-[4-[(2,6-dimethylmorpholin-4-yl)methyl]octa-3,5,7-trienoxy]pyrimidin-4-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanamine.
| Compound Name | [2-[4-[(2,6-dimethylmorpholin-4-yl)methyl]octa-3,5,7-trienoxy]pyrimidin-4-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanamine |
|---|---|
| PubChem CID | 123637489 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [2-[4-[(2,6-dimethylmorpholin-4-yl)methyl]octa-3,5,7-trienoxy]pyrimidin-4-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanamine |
| SMILES | C=CC=CC(=CCCOc1nccc(C(N)c2nc3cccnc3s2)n1)CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C26H32N6O2S/c1-4-5-8-20(17-32-15-18(2)34-19(3)16-32)9-7-14-33-26-29-13-11-21(31-26)23(27)25-30-22-10-6-12-28-24(22)35-25/h4-6,8-13,18-19,23H,1,7,14-17,27H2,2-3H3 |
| InChIKey | HBLJCZJSCXLEBN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|