C20H24S3Si — CID 123638752
7-hexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 123638752) has the molecular formula C20H24S3Si and a molecular weight of 388.70 g/mol. Its IUPAC name is 7-hexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-hexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 123638752 |
| Molecular Formula | C20H24S3Si |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 7-hexyl-4-methyl-10-(5-methylthiophen-2-yl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCC[SiH]1c2cc(C)sc2-c2sc(-c3ccc(C)s3)cc21 |
| InChI | InChI=1S/C20H24S3Si/c1-4-5-6-7-10-24-17-11-14(3)22-19(17)20-18(24)12-16(23-20)15-9-8-13(2)21-15/h8-9,11-12,24H,4-7,10H2,1-3H3 |
| InChIKey | PIIMHGKPFTYCIS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|