C17H22OS2Si — CID 173052439
7-octyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde (PubChem CID 173052439) has the molecular formula C17H22OS2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 7-octyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde.
| Compound Name | 7-octyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 173052439 |
| Molecular Formula | C17H22OS2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 7-octyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
| SMILES | CCCCCCCC[SiH]1c2ccsc2-c2sc(C=O)cc21 |
| InChI | InChI=1S/C17H22OS2Si/c1-2-3-4-5-6-7-10-21-14-8-9-19-16(14)17-15(21)11-13(12-18)20-17/h8-9,11-12,21H,2-7,10H2,1H3 |
| InChIKey | WXHFYYVQLHFUCV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|