C22H24FN7O — CID 123638818
1-[2-fluoro-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-(3-isocyano-3-methylbutyl)urea (PubChem CID 123638818) has the molecular formula C22H24FN7O and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[2-fluoro-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-(3-isocyano-3-methylbutyl)urea.
| Compound Name | 1-[2-fluoro-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-(3-isocyano-3-methylbutyl)urea |
|---|---|
| PubChem CID | 123638818 |
| Molecular Formula | C22H24FN7O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[2-fluoro-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-(3-isocyano-3-methylbutyl)urea |
| SMILES | [C-]#[N+]C(C)(C)CCNC(=O)Nc1cc(-c2cc3cnc(NC)nc3nc2C)ccc1F |
| InChI | InChI=1S/C22H24FN7O/c1-13-16(10-15-12-27-20(24-4)30-19(15)28-13)14-6-7-17(23)18(11-14)29-21(31)26-9-8-22(2,3)25-5/h6-7,10-12H,8-9H2,1-4H3,(H2,26,29,31)(H,24,27,28,30) |
| InChIKey | NTGBQHBOPFRZDU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|