C29H37FN6O3 — CID 135390058
1-[2-fluoro-4-methyl-5-[7-methyl-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-hexylurea (PubChem CID 135390058) has the molecular formula C29H37FN6O3 and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-[7-methyl-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-hexylurea.
| Compound Name | 1-[2-fluoro-4-methyl-5-[7-methyl-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-hexylurea |
|---|---|
| PubChem CID | 135390058 |
| Molecular Formula | C29H37FN6O3 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-[7-methyl-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]pyrido[2,3-d]pyrimidin-6-yl]phenyl]-3-hexylurea |
| SMILES | C#CCOCCOCCNc1ncc2cc(-c3cc(NC(=O)NCCCCCC)c(F)cc3C)c(C)nc2n1 |
| InChI | InChI=1S/C29H37FN6O3/c1-5-7-8-9-10-32-29(37)35-26-18-23(20(3)16-25(26)30)24-17-22-19-33-28(36-27(22)34-21(24)4)31-11-13-39-15-14-38-12-6-2/h2,16-19H,5,7-15H2,1,3-4H3,(H2,32,35,37)(H,31,33,34,36) |
| InChIKey | HMZZTEGMVPSWGH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|