C25H22FN5O3 — CID 155262780
benzyl 2-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]anilino]-2-oxoacetate (PubChem CID 155262780) has the molecular formula C25H22FN5O3 and a molecular weight of 459.48 g/mol. Its IUPAC name is benzyl 2-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]anilino]-2-oxoacetate.
| Compound Name | benzyl 2-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 155262780 |
| Molecular Formula | C25H22FN5O3 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | benzyl 2-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]anilino]-2-oxoacetate |
| SMILES | CNc1ncc2cc(-c3cc(NC(=O)C(=O)OCc4ccccc4)c(F)cc3C)c(C)nc2n1 |
| InChI | InChI=1S/C25H22FN5O3/c1-14-9-20(26)21(30-23(32)24(33)34-13-16-7-5-4-6-8-16)11-18(14)19-10-17-12-28-25(27-3)31-22(17)29-15(19)2/h4-12H,13H2,1-3H3,(H,30,32)(H,27,28,29,31) |
| InChIKey | QVRHVKVKDBGGDX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|