C17H19ClFN3O3 — CID 168928664
1-[5-[2-chloro-6-(2-hydroxyethoxy)-4-pyridinyl]-2-fluoro-4-methylphenyl]-3-ethylurea (PubChem CID 168928664) has the molecular formula C17H19ClFN3O3 and a molecular weight of 367.81 g/mol. Its IUPAC name is 1-[5-[2-chloro-6-(2-hydroxyethoxy)-4-pyridinyl]-2-fluoro-4-methylphenyl]-3-ethylurea.
| Compound Name | 1-[5-[2-chloro-6-(2-hydroxyethoxy)-4-pyridinyl]-2-fluoro-4-methylphenyl]-3-ethylurea |
|---|---|
| PubChem CID | 168928664 |
| Molecular Formula | C17H19ClFN3O3 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[5-[2-chloro-6-(2-hydroxyethoxy)-4-pyridinyl]-2-fluoro-4-methylphenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc(-c2cc(Cl)nc(OCCO)c2)c(C)cc1F |
| InChI | InChI=1S/C17H19ClFN3O3/c1-3-20-17(24)21-14-9-12(10(2)6-13(14)19)11-7-15(18)22-16(8-11)25-5-4-23/h6-9,23H,3-5H2,1-2H3,(H2,20,21,24) |
| InChIKey | TWYMOVZEKKRYBE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|