C28H38BFN2O5 — CID 170516554
1-[2-fluoro-5-[3-(2-hydroxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylphenyl]-3-[2-(1-methylcyclopropyl)ethyl]urea (PubChem CID 170516554) has the molecular formula C28H38BFN2O5 and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-[2-fluoro-5-[3-(2-hydroxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylphenyl]-3-[2-(1-methylcyclopropyl)ethyl]urea.
| Compound Name | 1-[2-fluoro-5-[3-(2-hydroxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylphenyl]-3-[2-(1-methylcyclopropyl)ethyl]urea |
|---|---|
| PubChem CID | 170516554 |
| Molecular Formula | C28H38BFN2O5 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 1-[2-fluoro-5-[3-(2-hydroxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylphenyl]-3-[2-(1-methylcyclopropyl)ethyl]urea |
| SMILES | Cc1cc(F)c(NC(=O)NCCC2(C)CC2)cc1-c1cc(OCCO)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C28H38BFN2O5/c1-18-13-23(30)24(32-25(34)31-10-9-28(6)7-8-28)17-22(18)19-14-20(16-21(15-19)35-12-11-33)29-36-26(2,3)27(4,5)37-29/h13-17,33H,7-12H2,1-6H3,(H2,31,32,34) |
| InChIKey | HMIDKLGONXHENQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|