C12H16Cl2N4O4 — CID 123639133
(diacetylamino) 4-[4,5-bis(chloromethyl)triazol-1-yl]butanoate (PubChem CID 123639133) has the molecular formula C12H16Cl2N4O4 and a molecular weight of 351.19 g/mol. Its IUPAC name is (diacetylamino) 4-[4,5-bis(chloromethyl)triazol-1-yl]butanoate.
| Compound Name | (diacetylamino) 4-[4,5-bis(chloromethyl)triazol-1-yl]butanoate |
|---|---|
| PubChem CID | 123639133 |
| Molecular Formula | C12H16Cl2N4O4 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (diacetylamino) 4-[4,5-bis(chloromethyl)triazol-1-yl]butanoate |
| SMILES | CC(=O)N(OC(=O)CCCn1nnc(CCl)c1CCl)C(C)=O |
| InChI | InChI=1S/C12H16Cl2N4O4/c1-8(19)18(9(2)20)22-12(21)4-3-5-17-11(7-14)10(6-13)15-16-17/h3-7H2,1-2H3 |
| InChIKey | PXBHUMWVWMSYAM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|