C6H7Cl2N3O2 — CID 126666316
2-[4,5-bis(chloromethyl)triazol-1-yl]acetic acid (PubChem CID 126666316) has the molecular formula C6H7Cl2N3O2 and a molecular weight of 224.05 g/mol. Its IUPAC name is 2-[4,5-bis(chloromethyl)triazol-1-yl]acetic acid.
| Compound Name | 2-[4,5-bis(chloromethyl)triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126666316 |
| Molecular Formula | C6H7Cl2N3O2 |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 2-[4,5-bis(chloromethyl)triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1nnc(CCl)c1CCl |
| InChI | InChI=1S/C6H7Cl2N3O2/c7-1-4-5(2-8)11(10-9-4)3-6(12)13/h1-3H2,(H,12,13) |
| InChIKey | SUXGPXKDFASIHB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|