C6H4F3N3O4 — CID 162414391
3-(carboxymethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 162414391) has the molecular formula C6H4F3N3O4 and a molecular weight of 239.11 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162414391 |
| Molecular Formula | C6H4F3N3O4 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 3-(carboxymethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)Cn1nnc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C6H4F3N3O4/c7-6(8,9)4-3(5(15)16)12(11-10-4)1-2(13)14/h1H2,(H,13,14)(H,15,16) |
| InChIKey | NUJAHOXVKKFJJJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |