C7H3F3IN3O2 — CID 121211570
1-(cyanomethyl)-4-iodo-3-(trifluoromethyl)pyrazole-5-carboxylic acid (PubChem CID 121211570) has the molecular formula C7H3F3IN3O2 and a molecular weight of 345.02 g/mol. Its IUPAC name is 1-(cyanomethyl)-4-iodo-3-(trifluoromethyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-(cyanomethyl)-4-iodo-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 121211570 |
| Molecular Formula | C7H3F3IN3O2 |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 1-(cyanomethyl)-4-iodo-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| SMILES | N#CCn1nc(C(F)(F)F)c(I)c1C(=O)O |
| InChI | InChI=1S/C7H3F3IN3O2/c8-7(9,10)5-3(11)4(6(15)16)14(13-5)2-1-12/h2H2,(H,15,16) |
| InChIKey | QJEHPONTTTYUOV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|