C14H17NO4 — CID 123639514
1-(hydroxymethyl)-3-(4-propan-2-yloxyphenyl)pyrrole-2,5-diol (PubChem CID 123639514) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3-(4-propan-2-yloxyphenyl)pyrrole-2,5-diol.
| Compound Name | 1-(hydroxymethyl)-3-(4-propan-2-yloxyphenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123639514 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-(hydroxymethyl)-3-(4-propan-2-yloxyphenyl)pyrrole-2,5-diol |
| SMILES | CC(C)Oc1ccc(-c2cc(O)n(CO)c2O)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-9(2)19-11-5-3-10(4-6-11)12-7-13(17)15(8-16)14(12)18/h3-7,9,16-18H,8H2,1-2H3 |
| InChIKey | OBSFZUUXCGDGOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |