C35H38Br2N2O3+2 — CID 123639940
[1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[(2-bromo-5-methoxyphenyl)methyl]quinolin-1-ium-4-yl]methanol (PubChem CID 123639940) has the molecular formula C35H38Br2N2O3+2 and a molecular weight of 694.51 g/mol. Its IUPAC name is [1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[(2-bromo-5-methoxyphenyl)methyl]quinolin-1-ium-4-yl]methanol.
| Compound Name | [1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[(2-bromo-5-methoxyphenyl)methyl]quinolin-1-ium-4-yl]methanol |
|---|---|
| PubChem CID | 123639940 |
| Molecular Formula | C35H38Br2N2O3+2 |
| Molecular Weight | 694.51 g/mol |
| Exact Mass | 692.12 |
| IUPAC Name | [1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[(2-bromo-5-methoxyphenyl)methyl]quinolin-1-ium-4-yl]methanol |
| SMILES | C=CC1C[N+]2(Cc3cc(OC)ccc3Br)CCC1CC2C(O)c1cc[n+](Cc2cc(OC)ccc2Br)c2ccccc12 |
| InChI | InChI=1S/C35H38Br2N2O3/c1-4-23-21-39(22-26-18-28(42-3)10-12-32(26)37)16-14-24(23)19-34(39)35(40)30-13-15-38(33-8-6-5-7-29(30)33)20-25-17-27(41-2)9-11-31(25)36/h4-13,15,17-18,23-24,34-35,40H,1,14,16,19-22H2,2-3H3/q+2 |
| InChIKey | FMHBFNCYYCOQRC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.51 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|