C28H30F3N2O2+ — CID 135084670
(R)-[5-ethenyl-1-[[2-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 135084670) has the molecular formula C28H30F3N2O2+ and a molecular weight of 483.55 g/mol. Its IUPAC name is (R)-[5-ethenyl-1-[[2-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[5-ethenyl-1-[[2-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 135084670 |
| Molecular Formula | C28H30F3N2O2+ |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (R)-[5-ethenyl-1-[[2-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3ccccc3C(F)(F)F)CCC1CC2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H30F3N2O2/c1-3-18-16-33(17-20-6-4-5-7-24(20)28(29,30)31)13-11-19(18)14-26(33)27(34)22-10-12-32-25-9-8-21(35-2)15-23(22)25/h3-10,12,15,18-19,26-27,34H,1,11,13-14,16-17H2,2H3/q+1/t18?,19?,26?,27-,33?/m1/s1 |
| InChIKey | OVSCXYNALOKEKF-KQDBVGNHSA-N |
| XLogP | 5.91 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|