C28H30BrN3O2 — CID 135084803
2-[[5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide (PubChem CID 135084803) has the molecular formula C28H30BrN3O2 and a molecular weight of 520.47 g/mol. Its IUPAC name is 2-[[5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide.
| Compound Name | 2-[[5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide |
|---|---|
| PubChem CID | 135084803 |
| Molecular Formula | C28H30BrN3O2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 2-[[5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]benzonitrile bromide |
| SMILES | C=CC1C[N+]2(Cc3ccccc3C#N)CCC1CC2[C@H](O)c1ccnc2ccc(OC)cc12.[Br-] |
| InChI | InChI=1S/C28H30N3O2.BrH/c1-3-19-17-31(18-22-7-5-4-6-21(22)16-29)13-11-20(19)14-27(31)28(32)24-10-12-30-26-9-8-23(33-2)15-25(24)26;/h3-10,12,15,19-20,27-28,32H,1,11,13-14,17-18H2,2H3;1H/q+1;/p-1/t19?,20?,27?,28-,31?;/m1./s1 |
| InChIKey | JBTPYYCOGHFRBH-LHNFTVPTSA-M |
| XLogP | 1.76 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|