C29H35N2O2+ — CID 15424165
(S)-[(2R,4S,5R)-1-[(2,4-dimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 15424165) has the molecular formula C29H35N2O2+ and a molecular weight of 443.61 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-1-[(2,4-dimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (S)-[(2R,4S,5R)-1-[(2,4-dimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 15424165 |
| Molecular Formula | C29H35N2O2+ |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | (S)-[(2R,4S,5R)-1-[(2,4-dimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3ccc(C)cc3C)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H35N2O2/c1-5-21-17-31(18-23-7-6-19(2)14-20(23)3)13-11-22(21)15-28(31)29(32)25-10-12-30-27-9-8-24(33-4)16-26(25)27/h5-10,12,14,16,21-22,28-29,32H,1,11,13,15,17-18H2,2-4H3/q+1/t21-,22-,28+,29-,31?/m0/s1 |
| InChIKey | HTBKNJQEFWUXHZ-PAXRQQJESA-N |
| XLogP | 5.51 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|