C28H31BrCl2N2O3 — CID 162339430
(R)-[1-[(2,3-dichloro-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol bromide (PubChem CID 162339430) has the molecular formula C28H31BrCl2N2O3 and a molecular weight of 594.38 g/mol. Its IUPAC name is (R)-[1-[(2,3-dichloro-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol bromide.
| Compound Name | (R)-[1-[(2,3-dichloro-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol bromide |
|---|---|
| PubChem CID | 162339430 |
| Molecular Formula | C28H31BrCl2N2O3 |
| Molecular Weight | 594.38 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | (R)-[1-[(2,3-dichloro-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol bromide |
| SMILES | C=CC1C[N+]2(Cc3ccc(OC)c(Cl)c3Cl)CCC1CC2[C@H](O)c1ccnc2ccc(OC)cc12.[Br-] |
| InChI | InChI=1S/C28H31Cl2N2O3.BrH/c1-4-17-15-32(16-19-5-8-25(35-3)27(30)26(19)29)12-10-18(17)13-24(32)28(33)21-9-11-31-23-7-6-20(34-2)14-22(21)23;/h4-9,11,14,17-18,24,28,33H,1,10,12-13,15-16H2,2-3H3;1H/q+1;/p-1/t17?,18?,24?,28-,32?;/m1./s1 |
| InChIKey | REHPVNXYAGADRC-PXRNEBBSSA-M |
| XLogP | 3.21 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|