C28H30Cl2N2O4 — CID 160838779
(R)-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol chloride (PubChem CID 160838779) has the molecular formula C28H30Cl2N2O4 and a molecular weight of 529.46 g/mol. Its IUPAC name is (R)-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol chloride.
| Compound Name | (R)-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol chloride |
|---|---|
| PubChem CID | 160838779 |
| Molecular Formula | C28H30Cl2N2O4 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | (R)-[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol chloride |
| SMILES | C=CC1C[N+]2(Cc3cc4c(cc3Cl)OCO4)CCC1CC2[C@H](O)c1ccnc2ccc(OC)cc12.[Cl-] |
| InChI | InChI=1S/C28H30ClN2O4.ClH/c1-3-17-14-31(15-19-11-26-27(13-23(19)29)35-16-34-26)9-7-18(17)10-25(31)28(32)21-6-8-30-24-5-4-20(33-2)12-22(21)24;/h3-6,8,11-13,17-18,25,28,32H,1,7,9-10,14-16H2,2H3;1H/q+1;/p-1/t17?,18?,25?,28-,31?;/m1./s1 |
| InChIKey | CLQKUSNVYHZZBV-QJDNKHDMSA-M |
| XLogP | 2.27 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|