C34H40B2N2O6+2 — CID 59303587
[4-[[4-[[1-[(4-boronophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-7-methoxyquinolin-1-ium-1-yl]methyl]phenyl]boronic acid (PubChem CID 59303587) has the molecular formula C34H40B2N2O6+2 and a molecular weight of 594.33 g/mol. Its IUPAC name is [4-[[4-[[1-[(4-boronophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-7-methoxyquinolin-1-ium-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[[1-[(4-boronophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-7-methoxyquinolin-1-ium-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59303587 |
| Molecular Formula | C34H40B2N2O6+2 |
| Molecular Weight | 594.33 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | [4-[[4-[[1-[(4-boronophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]-7-methoxyquinolin-1-ium-1-yl]methyl]phenyl]boronic acid |
| SMILES | C=CC1C[N+]2(Cc3ccc(B(O)O)cc3)CCC1CC2C(O)c1cc[n+](Cc2ccc(B(O)O)cc2)c2cc(OC)ccc12 |
| InChI | InChI=1S/C34H40B2N2O6/c1-3-25-22-38(21-24-6-10-28(11-7-24)36(42)43)17-15-26(25)18-33(38)34(39)31-14-16-37(32-19-29(44-2)12-13-30(31)32)20-23-4-8-27(9-5-23)35(40)41/h3-14,16,19,25-26,33-34,39-43H,1,15,17-18,20-22H2,2H3/q+2 |
| InChIKey | HPCSBEHFBBPHQL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|