C11H15N — CID 123640916
N-pent-2-en-3-ylhexa-1,4,5-trien-1-imine (PubChem CID 123640916) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is N-pent-2-en-3-ylhexa-1,4,5-trien-1-imine.
| Compound Name | N-pent-2-en-3-ylhexa-1,4,5-trien-1-imine |
|---|---|
| PubChem CID | 123640916 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-pent-2-en-3-ylhexa-1,4,5-trien-1-imine |
| SMILES | C=C=CCC=C=NC(=CC)CC |
| InChI | InChI=1S/C11H15N/c1-4-7-8-9-10-12-11(5-2)6-3/h5,7,9H,1,6,8H2,2-3H3 |
| InChIKey | NBNMNBCZVMMRPN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|