About N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine
N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine (PubChem CID 90908708) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine.
Molecular Properties
| Compound Name | N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine |
| PubChem CID | 90908708 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine |
| SMILES | C=CC=C(N=C=CC)C(C)C |
| InChI | InChI=1S/C10H15N/c1-5-7-10(9(3)4)11-8-6-2/h5-7,9H,1H2,2-4H3 |
| InChIKey | HVFKHAIFBQJJDN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine?
The IUPAC name of N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine (CID 90908708) is N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine.
What is the SMILES notation for N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine?
The canonical SMILES for N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine is C=CC=C(N=C=CC)C(C)C.
What is the InChIKey of N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine?
The InChIKey is HVFKHAIFBQJJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-5-7-10(9(3)4)11-8-6-2/h5-7,9H,1H2,2-4H3.
What are the key properties of N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine?
N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine has a molecular weight of 149.24 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylhexa-3,5-dien-3-yl)prop-1-en-1-imine is sourced from PubChem (CID 90908708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).