C8H12FN — CID 171630746
N-[(3Z)-5-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine (PubChem CID 171630746) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is N-[(3Z)-5-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z)-5-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 171630746 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | N-[(3Z)-5-fluoro-2-methylhexa-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C(=C)F)C(C)C |
| InChI | InChI=1S/C8H12FN/c1-6(2)8(10-4)5-7(3)9/h5-6H,3-4H2,1-2H3/b8-5- |
| InChIKey | BQIRSYWXXCJAGM-YVMONPNESA-N |
| XLogP | 2.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|